About 6-imino-8,8-dimethoxyoctan-2-ol
6-imino-8,8-dimethoxyoctan-2-ol (PubChem CID 174351561) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-imino-8,8-dimethoxyoctan-2-ol.
Molecular Properties
| Compound Name | 6-imino-8,8-dimethoxyoctan-2-ol |
| PubChem CID | 174351561 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 6-imino-8,8-dimethoxyoctan-2-ol |
| SMILES | [H]/N=C(\CCCC(C)O)CC(OC)OC |
| InChI | InChI=1S/C10H21NO3/c1-8(12)5-4-6-9(11)7-10(13-2)14-3/h8,10-12H,4-7H2,1-3H3/b11-9+ |
| InChIKey | RCGSOKVCDMGCJB-PKNBQFBNSA-N |
| XLogP | 1.57 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-8,8-dimethoxyoctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-8,8-dimethoxyoctan-2-ol?
The IUPAC name of 6-imino-8,8-dimethoxyoctan-2-ol (CID 174351561) is 6-imino-8,8-dimethoxyoctan-2-ol.
What is the SMILES notation for 6-imino-8,8-dimethoxyoctan-2-ol?
The canonical SMILES for 6-imino-8,8-dimethoxyoctan-2-ol is [H]/N=C(\CCCC(C)O)CC(OC)OC.
What is the InChIKey of 6-imino-8,8-dimethoxyoctan-2-ol?
The InChIKey is RCGSOKVCDMGCJB-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H21NO3/c1-8(12)5-4-6-9(11)7-10(13-2)14-3/h8,10-12H,4-7H2,1-3H3/b11-9+.
What are the key properties of 6-imino-8,8-dimethoxyoctan-2-ol?
6-imino-8,8-dimethoxyoctan-2-ol has a molecular weight of 203.28 g/mol, XLogP of 1.57, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-8,8-dimethoxyoctan-2-ol is sourced from PubChem (CID 174351561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).