C18H33ClN4 — CID 174351795
(1E,3E)-4-chloro-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine (PubChem CID 174351795) has the molecular formula C18H33ClN4 and a molecular weight of 340.94 g/mol. Its IUPAC name is (1E,3E)-4-chloro-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3E)-4-chloro-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 174351795 |
| Molecular Formula | C18H33ClN4 |
| Molecular Weight | 340.94 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1E,3E)-4-chloro-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CC(C)(C)CCN1CCC2(CC1)CC2CN/C(N)=C/C=C(\N)Cl |
| InChI | InChI=1S/C18H33ClN4/c1-17(2,3)6-9-23-10-7-18(8-11-23)12-14(18)13-22-16(21)5-4-15(19)20/h4-5,14,22H,6-13,20-21H2,1-3H3/b15-4-,16-5+ |
| InChIKey | TVYVQDXKTFJZHL-PEKKIUAKSA-N |
| XLogP | 2.95 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.94 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|