About 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide
6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide (PubChem CID 174351892) has the molecular formula C9H9F3N2O3S
and a molecular weight of 282.24 g/mol. Its IUPAC name is 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide |
| PubChem CID | 174351892 |
| Molecular Formula | C9H9F3N2O3S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc(C=O)n1)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O3S/c1-6(9(10,11)12)14-18(16,17)8-4-2-3-7(5-15)13-8/h2-6,14H,1H3 |
| InChIKey | HTDHGJZEZUWHLX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide?
The IUPAC name of 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide (CID 174351892) is 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide.
What is the SMILES notation for 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide?
The canonical SMILES for 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide is CC(NS(=O)(=O)c1cccc(C=O)n1)C(F)(F)F.
What is the InChIKey of 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide?
The InChIKey is HTDHGJZEZUWHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2O3S/c1-6(9(10,11)12)14-18(16,17)8-4-2-3-7(5-15)13-8/h2-6,14H,1H3.
What are the key properties of 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide?
6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide has a molecular weight of 282.24 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-2-sulfonamide is sourced from PubChem (CID 174351892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).