C16H22N2 — CID 174352020
(2Z)-3-methyl-2-[(Z)-1-(4-methylcyclohexa-2,4-dien-1-yl)prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 174352020) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (2Z)-3-methyl-2-[(Z)-1-(4-methylcyclohexa-2,4-dien-1-yl)prop-1-enyl]penta-2,4-dienimidamide.
| Compound Name | (2Z)-3-methyl-2-[(Z)-1-(4-methylcyclohexa-2,4-dien-1-yl)prop-1-enyl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 174352020 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2Z)-3-methyl-2-[(Z)-1-(4-methylcyclohexa-2,4-dien-1-yl)prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(C(=C\C)/C1C=CC(C)=CC1)=C(/C)C=C |
| InChI | InChI=1S/C16H22N2/c1-5-12(4)15(16(17)18)14(6-2)13-9-7-11(3)8-10-13/h5-9,13H,1,10H2,2-4H3,(H3,17,18)/b14-6-,15-12- |
| InChIKey | NAHLTMMPPBPKKM-DZGURXQASA-N |
| XLogP | 3.89 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|