C17H26S — CID 174352622
6,8,10-trimethylpentacyclo[7.5.0.02,7.03,5.011,14]tetradecane-13-thiol (PubChem CID 174352622) has the molecular formula C17H26S and a molecular weight of 262.46 g/mol. Its IUPAC name is 6,8,10-trimethylpentacyclo[7.5.0.02,7.03,5.011,14]tetradecane-13-thiol.
| Compound Name | 6,8,10-trimethylpentacyclo[7.5.0.02,7.03,5.011,14]tetradecane-13-thiol |
|---|---|
| PubChem CID | 174352622 |
| Molecular Formula | C17H26S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6,8,10-trimethylpentacyclo[7.5.0.02,7.03,5.011,14]tetradecane-13-thiol |
| SMILES | CC1C2CC2C2C1C(C)C1C(C)C3CC(S)C3C12 |
| InChI | InChI=1S/C17H26S/c1-6-9-4-11(9)16-13(6)8(3)14-7(2)10-5-12(18)15(10)17(14)16/h6-18H,4-5H2,1-3H3 |
| InChIKey | QZPPHIFEGKHIMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|