About dichlorotitanium;2,3-diethylcyclopenta-1,3-diene
dichlorotitanium;2,3-diethylcyclopenta-1,3-diene (PubChem CID 174352745) has the molecular formula C9H14Cl2Ti
and a molecular weight of 240.98 g/mol. Its IUPAC name is dichlorotitanium;2,3-diethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | dichlorotitanium;2,3-diethylcyclopenta-1,3-diene |
| PubChem CID | 174352745 |
| Molecular Formula | C9H14Cl2Ti |
| Molecular Weight | 240.98 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | dichlorotitanium;2,3-diethylcyclopenta-1,3-diene |
| SMILES | CCC1=CCC=C1CC.Cl[Ti]Cl |
| InChI | InChI=1S/C9H14.2ClH.Ti/c1-3-8-6-5-7-9(8)4-2;;;/h6-7H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YQAVKDMLUHMFOO-UHFFFAOYSA-L |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.98 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorotitanium;2,3-diethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;2,3-diethylcyclopenta-1,3-diene?
The IUPAC name of dichlorotitanium;2,3-diethylcyclopenta-1,3-diene (CID 174352745) is dichlorotitanium;2,3-diethylcyclopenta-1,3-diene.
What is the SMILES notation for dichlorotitanium;2,3-diethylcyclopenta-1,3-diene?
The canonical SMILES for dichlorotitanium;2,3-diethylcyclopenta-1,3-diene is CCC1=CCC=C1CC.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;2,3-diethylcyclopenta-1,3-diene?
The InChIKey is YQAVKDMLUHMFOO-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H14.2ClH.Ti/c1-3-8-6-5-7-9(8)4-2;;;/h6-7H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;2,3-diethylcyclopenta-1,3-diene?
dichlorotitanium;2,3-diethylcyclopenta-1,3-diene has a molecular weight of 240.98 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;2,3-diethylcyclopenta-1,3-diene is sourced from PubChem (CID 174352745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).