C17H14O3 — CID 174352835
bis(2,3-dihydro-1-benzofuran-3-yl)methanone (PubChem CID 174352835) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is bis(2,3-dihydro-1-benzofuran-3-yl)methanone.
| Compound Name | bis(2,3-dihydro-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 174352835 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | bis(2,3-dihydro-1-benzofuran-3-yl)methanone |
| SMILES | O=C(C1COc2ccccc21)C1COc2ccccc21 |
| InChI | InChI=1S/C17H14O3/c18-17(13-9-19-15-7-3-1-5-11(13)15)14-10-20-16-8-4-2-6-12(14)16/h1-8,13-14H,9-10H2 |
| InChIKey | VZXZNPDMDIGXCF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |