About 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole
5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole (PubChem CID 174353049) has the molecular formula C15H21N5O3S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole |
| PubChem CID | 174353049 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole |
| SMILES | COCCS(=O)(=O)N1CC(n2nnc(-c3ccc(C)c(C)c3)n2)C1 |
| InChI | InChI=1S/C15H21N5O3S/c1-11-4-5-13(8-12(11)2)15-16-18-20(17-15)14-9-19(10-14)24(21,22)7-6-23-3/h4-5,8,14H,6-7,9-10H2,1-3H3 |
| InChIKey | WCFLDOKRLWBJNI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole?
The IUPAC name of 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole (CID 174353049) is 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole?
The canonical SMILES for 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole is COCCS(=O)(=O)N1CC(n2nnc(-c3ccc(C)c(C)c3)n2)C1.
What is the InChIKey of 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole?
The InChIKey is WCFLDOKRLWBJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O3S/c1-11-4-5-13(8-12(11)2)15-16-18-20(17-15)14-9-19(10-14)24(21,22)7-6-23-3/h4-5,8,14H,6-7,9-10H2,1-3H3.
What are the key properties of 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole?
5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole has a molecular weight of 351.43 g/mol, XLogP of 0.79, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-2-[1-(2-methoxyethylsulfonyl)azetidin-3-yl]tetrazole is sourced from PubChem (CID 174353049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).