About potassium;hydride;sulfosulfamic acid
potassium;hydride;sulfosulfamic acid (PubChem CID 174353102) has the molecular formula H4KNO6S2
and a molecular weight of 217.27 g/mol. Its IUPAC name is potassium;hydride;sulfosulfamic acid.
Molecular Properties
| Compound Name | potassium;hydride;sulfosulfamic acid |
| PubChem CID | 174353102 |
| Molecular Formula | H4KNO6S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 216.91 |
| IUPAC Name | potassium;hydride;sulfosulfamic acid |
| SMILES | O=S(=O)(O)NS(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/K.H3NO6S2.H/c;2-8(3,4)1-9(5,6)7;/h;1H,(H,2,3,4)(H,5,6,7);/q+1;;-1 |
| InChIKey | UFDOWHBPQDDKEM-UHFFFAOYSA-N |
| XLogP | -4.70 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;sulfosulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;sulfosulfamic acid?
The IUPAC name of potassium;hydride;sulfosulfamic acid (CID 174353102) is potassium;hydride;sulfosulfamic acid.
What is the SMILES notation for potassium;hydride;sulfosulfamic acid?
The canonical SMILES for potassium;hydride;sulfosulfamic acid is O=S(=O)(O)NS(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;sulfosulfamic acid?
The InChIKey is UFDOWHBPQDDKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/K.H3NO6S2.H/c;2-8(3,4)1-9(5,6)7;/h;1H,(H,2,3,4)(H,5,6,7);/q+1;;-1.
What are the key properties of potassium;hydride;sulfosulfamic acid?
potassium;hydride;sulfosulfamic acid has a molecular weight of 217.27 g/mol, XLogP of -4.70, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;sulfosulfamic acid is sourced from PubChem (CID 174353102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).