About 8-ethyl-5H-indeno[1,2-d]pyrimidine
8-ethyl-5H-indeno[1,2-d]pyrimidine (PubChem CID 174353107) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 8-ethyl-5H-indeno[1,2-d]pyrimidine.
Molecular Properties
| Compound Name | 8-ethyl-5H-indeno[1,2-d]pyrimidine |
| PubChem CID | 174353107 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 8-ethyl-5H-indeno[1,2-d]pyrimidine |
| SMILES | CCc1ccc2c(c1)-c1ncncc1C2 |
| InChI | InChI=1S/C13H12N2/c1-2-9-3-4-10-6-11-7-14-8-15-13(11)12(10)5-9/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | WZOYITYRJMWIET-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-5H-indeno[1,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-5H-indeno[1,2-d]pyrimidine?
The IUPAC name of 8-ethyl-5H-indeno[1,2-d]pyrimidine (CID 174353107) is 8-ethyl-5H-indeno[1,2-d]pyrimidine.
What is the SMILES notation for 8-ethyl-5H-indeno[1,2-d]pyrimidine?
The canonical SMILES for 8-ethyl-5H-indeno[1,2-d]pyrimidine is CCc1ccc2c(c1)-c1ncncc1C2.
What is the InChIKey of 8-ethyl-5H-indeno[1,2-d]pyrimidine?
The InChIKey is WZOYITYRJMWIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-9-3-4-10-6-11-7-14-8-15-13(11)12(10)5-9/h3-5,7-8H,2,6H2,1H3.
What are the key properties of 8-ethyl-5H-indeno[1,2-d]pyrimidine?
8-ethyl-5H-indeno[1,2-d]pyrimidine has a molecular weight of 196.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-5H-indeno[1,2-d]pyrimidine is sourced from PubChem (CID 174353107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).