C22H26N6O2 — CID 174353382
N-[2-(4-ethoxyphenyl)ethyl]-2-(2-imidazol-1-ylpyrimidine-4-carboximidoyl)butanamide (PubChem CID 174353382) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)ethyl]-2-(2-imidazol-1-ylpyrimidine-4-carboximidoyl)butanamide.
| Compound Name | N-[2-(4-ethoxyphenyl)ethyl]-2-(2-imidazol-1-ylpyrimidine-4-carboximidoyl)butanamide |
|---|---|
| PubChem CID | 174353382 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)ethyl]-2-(2-imidazol-1-ylpyrimidine-4-carboximidoyl)butanamide |
| SMILES | [H]/N=C(/c1ccnc(-n2ccnc2)n1)C(CC)C(=O)NCCc1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-3-18(20(23)19-10-12-26-22(27-19)28-14-13-24-15-28)21(29)25-11-9-16-5-7-17(8-6-16)30-4-2/h5-8,10,12-15,18,23H,3-4,9,11H2,1-2H3,(H,25,29)/b23-20+ |
| InChIKey | FDUXDDPVBUWYOR-BSYVCWPDSA-N |
| XLogP | 2.81 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|