C18H16ClF2NO4 — CID 174353580
[6-chloro-4-[(E)-2-(3,5-difluorophenyl)ethenyl]-7-methoxy-2,3-dihydro-1,4-benzoxazin-8-yl]methanediol (PubChem CID 174353580) has the molecular formula C18H16ClF2NO4 and a molecular weight of 383.78 g/mol. Its IUPAC name is [6-chloro-4-[(E)-2-(3,5-difluorophenyl)ethenyl]-7-methoxy-2,3-dihydro-1,4-benzoxazin-8-yl]methanediol.
| Compound Name | [6-chloro-4-[(E)-2-(3,5-difluorophenyl)ethenyl]-7-methoxy-2,3-dihydro-1,4-benzoxazin-8-yl]methanediol |
|---|---|
| PubChem CID | 174353580 |
| Molecular Formula | C18H16ClF2NO4 |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [6-chloro-4-[(E)-2-(3,5-difluorophenyl)ethenyl]-7-methoxy-2,3-dihydro-1,4-benzoxazin-8-yl]methanediol |
| SMILES | COc1c(Cl)cc2c(c1C(O)O)OCCN2/C=C/c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H16ClF2NO4/c1-25-16-13(19)9-14-17(15(16)18(23)24)26-5-4-22(14)3-2-10-6-11(20)8-12(21)7-10/h2-3,6-9,18,23-24H,4-5H2,1H3/b3-2+ |
| InChIKey | HYATWSCHVHZLMP-NSCUHMNNSA-N |
| XLogP | 3.48 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|