C20H32O5 — CID 174353697
2-[[(2R,3aS,4S,7aS)-4-ethenyl-2,3,3a,4,5,7a-hexahydro-1H-inden-2-yl]oxy]-3,4,5-trimethoxy-6-methyloxane (PubChem CID 174353697) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[[(2R,3aS,4S,7aS)-4-ethenyl-2,3,3a,4,5,7a-hexahydro-1H-inden-2-yl]oxy]-3,4,5-trimethoxy-6-methyloxane.
| Compound Name | 2-[[(2R,3aS,4S,7aS)-4-ethenyl-2,3,3a,4,5,7a-hexahydro-1H-inden-2-yl]oxy]-3,4,5-trimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 174353697 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[[(2R,3aS,4S,7aS)-4-ethenyl-2,3,3a,4,5,7a-hexahydro-1H-inden-2-yl]oxy]-3,4,5-trimethoxy-6-methyloxane |
| SMILES | C=C[C@@H]1CC=C[C@@H]2C[C@@H](OC3OC(C)C(OC)C(OC)C3OC)C[C@@H]12 |
| InChI | InChI=1S/C20H32O5/c1-6-13-8-7-9-14-10-15(11-16(13)14)25-20-19(23-5)18(22-4)17(21-3)12(2)24-20/h6-7,9,12-20H,1,8,10-11H2,2-5H3/t12?,13-,14-,15-,16+,17?,18?,19?,20?/m1/s1 |
| InChIKey | WGCIWKQDZITVPX-BPEYHYIGSA-N |
| XLogP | 2.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|