C32H46N4O5 — CID 174354226
(2S,3S,4R)-N-[4-(benzylamino)-1-cyclopropyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-(prop-2-enoylamino)butanoyl]-4-methyl-3-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 174354226) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is (2S,3S,4R)-N-[4-(benzylamino)-1-cyclopropyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-(prop-2-enoylamino)butanoyl]-4-methyl-3-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3S,4R)-N-[4-(benzylamino)-1-cyclopropyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-(prop-2-enoylamino)butanoyl]-4-methyl-3-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174354226 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | (2S,3S,4R)-N-[4-(benzylamino)-1-cyclopropyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-(prop-2-enoylamino)butanoyl]-4-methyl-3-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N[C@H](C(=O)N1C[C@H](C)[C@H](C(C)C)[C@H]1C(=O)NC(CC1CC1)C(=O)C(=O)NCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H46N4O5/c1-8-24(37)35-28(32(5,6)7)31(41)36-18-20(4)25(19(2)3)26(36)29(39)34-23(16-21-14-15-21)27(38)30(40)33-17-22-12-10-9-11-13-22/h8-13,19-21,23,25-26,28H,1,14-18H2,2-7H3,(H,33,40)(H,34,39)(H,35,37)/t20-,23?,25-,26-,28+/m0/s1 |
| InChIKey | IVHOJLSYABFARS-YKEQMGPRSA-N |
| XLogP | 2.99 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|