C37H42N4 — CID 174354347
9-[(1R)-3-[(6R)-6-(1,2,4a,5,7,8,9,10,10a,10b-decahydrophenanthridin-6-yl)-3,6-dihydro-2H-azepin-2-yl]cyclohexa-2,4-dien-1-yl]-1,2,6a,10a-tetrahydro-1,10-phenanthroline (PubChem CID 174354347) has the molecular formula C37H42N4 and a molecular weight of 542.77 g/mol. Its IUPAC name is 9-[(1R)-3-[(6R)-6-(1,2,4a,5,7,8,9,10,10a,10b-decahydrophenanthridin-6-yl)-3,6-dihydro-2H-azepin-2-yl]cyclohexa-2,4-dien-1-yl]-1,2,6a,10a-tetrahydro-1,10-phenanthroline.
| Compound Name | 9-[(1R)-3-[(6R)-6-(1,2,4a,5,7,8,9,10,10a,10b-decahydrophenanthridin-6-yl)-3,6-dihydro-2H-azepin-2-yl]cyclohexa-2,4-dien-1-yl]-1,2,6a,10a-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 174354347 |
| Molecular Formula | C37H42N4 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 9-[(1R)-3-[(6R)-6-(1,2,4a,5,7,8,9,10,10a,10b-decahydrophenanthridin-6-yl)-3,6-dihydro-2H-azepin-2-yl]cyclohexa-2,4-dien-1-yl]-1,2,6a,10a-tetrahydro-1,10-phenanthroline |
| SMILES | C1=CC2NC([C@H]3C=CCC(C4=C[C@H](C5=NC6C7=C(C=CCN7)C=CC6C=C5)CC=C4)N=C3)=C3CCCCC3C2CC1 |
| InChI | InChI=1S/C37H42N4/c1-2-14-31-29(12-1)30-13-3-4-15-34(30)41-35(31)28-10-6-16-32(39-23-28)26-8-5-9-27(22-26)33-20-19-25-18-17-24-11-7-21-38-36(24)37(25)40-33/h4-8,10-11,15,17-20,22-23,25,27-30,32,34,37-38,41H,1-3,9,12-14,16,21H2/t25?,27-,28+,29?,30?,32?,34?,37?/m1/s1 |
| InChIKey | GOQCMLPMYKLQSX-JUVGZEGOSA-N |
| XLogP | 6.87 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|