C22H28N2 — CID 174354354
(10aR)-2-(3,4-dihydropyridin-2-yl)-3-methyl-4-propyl-2,3,6a,7,8,10a-hexahydrobenzo[h]quinoline (PubChem CID 174354354) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (10aR)-2-(3,4-dihydropyridin-2-yl)-3-methyl-4-propyl-2,3,6a,7,8,10a-hexahydrobenzo[h]quinoline.
| Compound Name | (10aR)-2-(3,4-dihydropyridin-2-yl)-3-methyl-4-propyl-2,3,6a,7,8,10a-hexahydrobenzo[h]quinoline |
|---|---|
| PubChem CID | 174354354 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (10aR)-2-(3,4-dihydropyridin-2-yl)-3-methyl-4-propyl-2,3,6a,7,8,10a-hexahydrobenzo[h]quinoline |
| SMILES | CCCC1=C2C=CC3CCC=C[C@H]3C2=NC(C2=NC=CCC2)C1C |
| InChI | InChI=1S/C22H28N2/c1-3-8-17-15(2)21(20-11-6-7-14-23-20)24-22-18-10-5-4-9-16(18)12-13-19(17)22/h5,7,10,12-16,18,21H,3-4,6,8-9,11H2,1-2H3/t15?,16?,18-,21?/m1/s1 |
| InChIKey | MMIIKHXUFLNCFS-QVFSOSOOSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|