C6H16O8Si2 — CID 174354493
2,2,6,6-tetramethoxy-1,3,5,7,2,6-tetraoxadisilocane (PubChem CID 174354493) has the molecular formula C6H16O8Si2 and a molecular weight of 272.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethoxy-1,3,5,7,2,6-tetraoxadisilocane.
| Compound Name | 2,2,6,6-tetramethoxy-1,3,5,7,2,6-tetraoxadisilocane |
|---|---|
| PubChem CID | 174354493 |
| Molecular Formula | C6H16O8Si2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2,2,6,6-tetramethoxy-1,3,5,7,2,6-tetraoxadisilocane |
| SMILES | CO[Si]1(OC)OCO[Si](OC)(OC)OCO1 |
| InChI | InChI=1S/C6H16O8Si2/c1-7-15(8-2)11-5-13-16(9-3,10-4)14-6-12-15/h5-6H2,1-4H3 |
| InChIKey | CUKYKYLQKAPEOX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|