C28H28N8O6S — CID 174354937
1-(benzenesulfonyl)-2-N'-(1,3-benzodioxol-5-ylmethyl)-4-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)piperazine-2,2-dicarboxamide (PubChem CID 174354937) has the molecular formula C28H28N8O6S and a molecular weight of 604.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-N'-(1,3-benzodioxol-5-ylmethyl)-4-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)piperazine-2,2-dicarboxamide.
| Compound Name | 1-(benzenesulfonyl)-2-N'-(1,3-benzodioxol-5-ylmethyl)-4-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)piperazine-2,2-dicarboxamide |
|---|---|
| PubChem CID | 174354937 |
| Molecular Formula | C28H28N8O6S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 1-(benzenesulfonyl)-2-N'-(1,3-benzodioxol-5-ylmethyl)-4-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)piperazine-2,2-dicarboxamide |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccccc3)C(C(N)=O)(C(=O)NCc3ccc4c(c3)OCO4)C2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C28H28N8O6S/c1-19-13-24(33-27(32-19)35-10-9-30-17-35)34-11-12-36(43(39,40)21-5-3-2-4-6-21)28(16-34,25(29)37)26(38)31-15-20-7-8-22-23(14-20)42-18-41-22/h2-10,13-14,17H,11-12,15-16,18H2,1H3,(H2,29,37)(H,31,38) |
| InChIKey | TZYPTGZMSKLBKM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 174.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|