C21H13N5 — CID 174355075
4-(4-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)benzonitrile (PubChem CID 174355075) has the molecular formula C21H13N5 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-(4-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)benzonitrile.
| Compound Name | 4-(4-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)benzonitrile |
|---|---|
| PubChem CID | 174355075 |
| Molecular Formula | C21H13N5 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-(4-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c(-c3ccccc3)nc3cnc4[nH]ccc4c32)cc1 |
| InChI | InChI=1S/C21H13N5/c22-12-14-6-8-16(9-7-14)26-19-17-10-11-23-20(17)24-13-18(19)25-21(26)15-4-2-1-3-5-15/h1-11,13H,(H,23,24) |
| InChIKey | HVQQSKFQEBDLDF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |