C9H5ClFN3O3S — CID 174355411
4-chloro-3-(4-fluoro-1,3,5-triazin-2-yl)benzenesulfonic acid (PubChem CID 174355411) has the molecular formula C9H5ClFN3O3S and a molecular weight of 289.68 g/mol. Its IUPAC name is 4-chloro-3-(4-fluoro-1,3,5-triazin-2-yl)benzenesulfonic acid.
| Compound Name | 4-chloro-3-(4-fluoro-1,3,5-triazin-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 174355411 |
| Molecular Formula | C9H5ClFN3O3S |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 4-chloro-3-(4-fluoro-1,3,5-triazin-2-yl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Cl)c(-c2ncnc(F)n2)c1 |
| InChI | InChI=1S/C9H5ClFN3O3S/c10-7-2-1-5(18(15,16)17)3-6(7)8-12-4-13-9(11)14-8/h1-4H,(H,15,16,17) |
| InChIKey | MPEGITQUEHACCF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|