About 6-methyldodecan-6-yl 4-aminobutanoate
6-methyldodecan-6-yl 4-aminobutanoate (PubChem CID 174355900) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is 6-methyldodecan-6-yl 4-aminobutanoate.
Molecular Properties
| Compound Name | 6-methyldodecan-6-yl 4-aminobutanoate |
| PubChem CID | 174355900 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 6-methyldodecan-6-yl 4-aminobutanoate |
| SMILES | CCCCCCC(C)(CCCCC)OC(=O)CCCN |
| InChI | InChI=1S/C17H35NO2/c1-4-6-8-10-14-17(3,13-9-7-5-2)20-16(19)12-11-15-18/h4-15,18H2,1-3H3 |
| InChIKey | DMWIDIZJXRFEDB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyldodecan-6-yl 4-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyldodecan-6-yl 4-aminobutanoate?
The IUPAC name of 6-methyldodecan-6-yl 4-aminobutanoate (CID 174355900) is 6-methyldodecan-6-yl 4-aminobutanoate.
What is the SMILES notation for 6-methyldodecan-6-yl 4-aminobutanoate?
The canonical SMILES for 6-methyldodecan-6-yl 4-aminobutanoate is CCCCCCC(C)(CCCCC)OC(=O)CCCN.
What is the InChIKey of 6-methyldodecan-6-yl 4-aminobutanoate?
The InChIKey is DMWIDIZJXRFEDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-4-6-8-10-14-17(3,13-9-7-5-2)20-16(19)12-11-15-18/h4-15,18H2,1-3H3.
What are the key properties of 6-methyldodecan-6-yl 4-aminobutanoate?
6-methyldodecan-6-yl 4-aminobutanoate has a molecular weight of 285.47 g/mol, XLogP of 4.58, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyldodecan-6-yl 4-aminobutanoate is sourced from PubChem (CID 174355900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).