About (4-methylimidazol-1-yl) 2,2-dimethylpropanoate
(4-methylimidazol-1-yl) 2,2-dimethylpropanoate (PubChem CID 174356329) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is (4-methylimidazol-1-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4-methylimidazol-1-yl) 2,2-dimethylpropanoate |
| PubChem CID | 174356329 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (4-methylimidazol-1-yl) 2,2-dimethylpropanoate |
| SMILES | Cc1cn(OC(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C9H14N2O2/c1-7-5-11(6-10-7)13-8(12)9(2,3)4/h5-6H,1-4H3 |
| InChIKey | VLVJINJGTRNROQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methylimidazol-1-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylimidazol-1-yl) 2,2-dimethylpropanoate?
The IUPAC name of (4-methylimidazol-1-yl) 2,2-dimethylpropanoate (CID 174356329) is (4-methylimidazol-1-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (4-methylimidazol-1-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (4-methylimidazol-1-yl) 2,2-dimethylpropanoate is Cc1cn(OC(=O)C(C)(C)C)cn1.
What is the InChIKey of (4-methylimidazol-1-yl) 2,2-dimethylpropanoate?
The InChIKey is VLVJINJGTRNROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-7-5-11(6-10-7)13-8(12)9(2,3)4/h5-6H,1-4H3.
What are the key properties of (4-methylimidazol-1-yl) 2,2-dimethylpropanoate?
(4-methylimidazol-1-yl) 2,2-dimethylpropanoate has a molecular weight of 182.22 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylimidazol-1-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 174356329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).