About N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine
N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine (PubChem CID 174356339) has the molecular formula C13H19BFNO2
and a molecular weight of 251.11 g/mol. Its IUPAC name is N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine |
| PubChem CID | 174356339 |
| Molecular Formula | C13H19BFNO2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine |
| SMILES | CCCN(C)CCOB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C13H19BFNO2/c1-3-6-16(2)7-8-17-14-13-5-4-12(15)9-11(13)10-18-14/h4-5,9H,3,6-8,10H2,1-2H3 |
| InChIKey | LTMJMJQWXFVFGH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine?
The IUPAC name of N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine (CID 174356339) is N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine.
What is the SMILES notation for N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine?
The canonical SMILES for N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine is CCCN(C)CCOB1OCc2cc(F)ccc21.
What is the InChIKey of N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine?
The InChIKey is LTMJMJQWXFVFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BFNO2/c1-3-6-16(2)7-8-17-14-13-5-4-12(15)9-11(13)10-18-14/h4-5,9H,3,6-8,10H2,1-2H3.
What are the key properties of N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine?
N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine has a molecular weight of 251.11 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]ethyl]-N-methylpropan-1-amine is sourced from PubChem (CID 174356339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).