About (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine
(Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine (PubChem CID 174356459) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine.
Molecular Properties
| Compound Name | (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine |
| PubChem CID | 174356459 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine |
| SMILES | C/N=C(/C=C\CCC(C)F)C(C)C |
| InChI | InChI=1S/C11H20FN/c1-9(2)11(13-4)8-6-5-7-10(3)12/h6,8-10H,5,7H2,1-4H3/b8-6-,13-11- |
| InChIKey | NBOIMDIKDBEGQF-MJQGXCIASA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine?
The IUPAC name of (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine (CID 174356459) is (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine.
What is the SMILES notation for (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine?
The canonical SMILES for (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine is C/N=C(/C=C\CCC(C)F)C(C)C.
What is the InChIKey of (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine?
The InChIKey is NBOIMDIKDBEGQF-MJQGXCIASA-N. The full InChI is InChI=1S/C11H20FN/c1-9(2)11(13-4)8-6-5-7-10(3)12/h6,8-10H,5,7H2,1-4H3/b8-6-,13-11-.
What are the key properties of (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine?
(Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine has a molecular weight of 185.29 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-8-fluoro-N,2-dimethylnon-4-en-3-imine is sourced from PubChem (CID 174356459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).