C13H22N2 — CID 174356829
(5Z,7Z)-1-ethyl-4,4,9,9-tetramethyl-1,3-diazonine (PubChem CID 174356829) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (5Z,7Z)-1-ethyl-4,4,9,9-tetramethyl-1,3-diazonine.
| Compound Name | (5Z,7Z)-1-ethyl-4,4,9,9-tetramethyl-1,3-diazonine |
|---|---|
| PubChem CID | 174356829 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (5Z,7Z)-1-ethyl-4,4,9,9-tetramethyl-1,3-diazonine |
| SMILES | CCN1/C=N\C(C)(C)/C=C\C=C/C1(C)C |
| InChI | InChI=1S/C13H22N2/c1-6-15-11-14-12(2,3)9-7-8-10-13(15,4)5/h7-11H,6H2,1-5H3/b9-7-,10-8-,14-11- |
| InChIKey | OEDZOPDBVDBOOM-ZFOSIZNQSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |