About 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate
1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate (PubChem CID 174357024) has the molecular formula C8H8N4O4
and a molecular weight of 224.18 g/mol. Its IUPAC name is 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate.
Molecular Properties
| Compound Name | 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate |
| PubChem CID | 174357024 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=C=O)N=2.O |
| InChI | InChI=1S/C8H6N4O3.H2O/c1-11-6-5(9-4(3-13)10-6)7(14)12(2)8(11)15;/h1-2H3;1H2 |
| InChIKey | FCPTXJMNHXORDP-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 117.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate?
The IUPAC name of 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate (CID 174357024) is 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate.
What is the SMILES notation for 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate?
The canonical SMILES for 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate is Cn1c(=O)c2c(n(C)c1=O)=NC(=C=O)N=2.O.
What is the InChIKey of 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate?
The InChIKey is FCPTXJMNHXORDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O3.H2O/c1-11-6-5(9-4(3-13)10-6)7(14)12(2)8(11)15;/h1-2H3;1H2.
What are the key properties of 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate?
1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate has a molecular weight of 224.18 g/mol, XLogP of -3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-8-(oxomethylidene)purine-2,6-dione;hydrate is sourced from PubChem (CID 174357024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).