About anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione
anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione (PubChem CID 174357555) has the molecular formula C31H20O4
and a molecular weight of 456.50 g/mol. Its IUPAC name is anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione.
Molecular Properties
| Compound Name | anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione |
| PubChem CID | 174357555 |
| Molecular Formula | C31H20O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione |
| SMILES | C=CCc1cccc2c1C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H12O2.C14H8O2/c1-2-6-11-7-5-10-14-15(11)17(19)13-9-4-3-8-12(13)16(14)18;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2-5,7-10H,1,6H2;1-8H |
| InChIKey | PSUHFNSYMMIILX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione?
The IUPAC name of anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione (CID 174357555) is anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione.
What is the SMILES notation for anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione?
The canonical SMILES for anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione is C=CCc1cccc2c1C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2ccccc21.
What is the InChIKey of anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione?
The InChIKey is PSUHFNSYMMIILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O2.C14H8O2/c1-2-6-11-7-5-10-14-15(11)17(19)13-9-4-3-8-12(13)16(14)18;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2-5,7-10H,1,6H2;1-8H.
What are the key properties of anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione?
anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione has a molecular weight of 456.50 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;1-prop-2-enylanthracene-9,10-dione is sourced from PubChem (CID 174357555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).