About 2-naphthalen-1-ylpyridine;quinoxaline
2-naphthalen-1-ylpyridine;quinoxaline (PubChem CID 174357892) has the molecular formula C23H17N3
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-naphthalen-1-ylpyridine;quinoxaline.
Molecular Properties
| Compound Name | 2-naphthalen-1-ylpyridine;quinoxaline |
| PubChem CID | 174357892 |
| Molecular Formula | C23H17N3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-naphthalen-1-ylpyridine;quinoxaline |
| SMILES | c1ccc(-c2cccc3ccccc23)nc1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C15H11N.C8H6N2/c1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-16-15;1-2-4-8-7(3-1)9-5-6-10-8/h1-11H;1-6H |
| InChIKey | HQCXGBOCPXIFPH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-naphthalen-1-ylpyridine;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-ylpyridine;quinoxaline?
The IUPAC name of 2-naphthalen-1-ylpyridine;quinoxaline (CID 174357892) is 2-naphthalen-1-ylpyridine;quinoxaline.
What is the SMILES notation for 2-naphthalen-1-ylpyridine;quinoxaline?
The canonical SMILES for 2-naphthalen-1-ylpyridine;quinoxaline is c1ccc(-c2cccc3ccccc23)nc1.c1ccc2nccnc2c1.
What is the InChIKey of 2-naphthalen-1-ylpyridine;quinoxaline?
The InChIKey is HQCXGBOCPXIFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.C8H6N2/c1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-16-15;1-2-4-8-7(3-1)9-5-6-10-8/h1-11H;1-6H.
What are the key properties of 2-naphthalen-1-ylpyridine;quinoxaline?
2-naphthalen-1-ylpyridine;quinoxaline has a molecular weight of 335.41 g/mol, XLogP of 5.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-ylpyridine;quinoxaline is sourced from PubChem (CID 174357892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).