About 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene
2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene (PubChem CID 174358301) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene.
Molecular Properties
| Compound Name | 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene |
| PubChem CID | 174358301 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene |
| SMILES | C=C(C)C#N.C=CC.N#CC#N |
| InChI | InChI=1S/C4H5N.C3H6.C2N2/c1-4(2)3-5;1-3-2;3-1-2-4/h1H2,2H3;3H,1H2,2H3; |
| InChIKey | LJJFSSPYWDRNIA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene?
The IUPAC name of 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene (CID 174358301) is 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene.
What is the SMILES notation for 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene?
The canonical SMILES for 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene is C=C(C)C#N.C=CC.N#CC#N.
What is the InChIKey of 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene?
The InChIKey is LJJFSSPYWDRNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N.C3H6.C2N2/c1-4(2)3-5;1-3-2;3-1-2-4/h1H2,2H3;3H,1H2,2H3;.
What are the key properties of 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene?
2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene has a molecular weight of 161.21 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enenitrile;oxalonitrile;prop-1-ene is sourced from PubChem (CID 174358301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).