C8H16O6S — CID 174358407
1,3,2-dioxathiolane 2,2-dioxide;3-prop-2-enoxyprop-1-ene;hydrate (PubChem CID 174358407) has the molecular formula C8H16O6S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1,3,2-dioxathiolane 2,2-dioxide;3-prop-2-enoxyprop-1-ene;hydrate.
| Compound Name | 1,3,2-dioxathiolane 2,2-dioxide;3-prop-2-enoxyprop-1-ene;hydrate |
|---|---|
| PubChem CID | 174358407 |
| Molecular Formula | C8H16O6S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1,3,2-dioxathiolane 2,2-dioxide;3-prop-2-enoxyprop-1-ene;hydrate |
| SMILES | C=CCOCC=C.O.O=S1(=O)OCCO1 |
| InChI | InChI=1S/C6H10O.C2H4O4S.H2O/c1-3-5-7-6-4-2;3-7(4)5-1-2-6-7;/h3-4H,1-2,5-6H2;1-2H2;1H2 |
| InChIKey | UQFIICXFXYXSPJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|