C15H17BN4O3 — CID 174358497
[4-[(6-carbamoylimidazo[4,5-c]pyridin-1-yl)methyl]-6-methylcyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 174358497) has the molecular formula C15H17BN4O3 and a molecular weight of 312.14 g/mol. Its IUPAC name is [4-[(6-carbamoylimidazo[4,5-c]pyridin-1-yl)methyl]-6-methylcyclohexa-2,4-dien-1-yl]boronic acid.
| Compound Name | [4-[(6-carbamoylimidazo[4,5-c]pyridin-1-yl)methyl]-6-methylcyclohexa-2,4-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 174358497 |
| Molecular Formula | C15H17BN4O3 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [4-[(6-carbamoylimidazo[4,5-c]pyridin-1-yl)methyl]-6-methylcyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | CC1C=C(Cn2cnc3cnc(C(N)=O)cc32)C=CC1B(O)O |
| InChI | InChI=1S/C15H17BN4O3/c1-9-4-10(2-3-11(9)16(22)23)7-20-8-19-13-6-18-12(15(17)21)5-14(13)20/h2-6,8-9,11,22-23H,7H2,1H3,(H2,17,21) |
| InChIKey | YOGPEMOEWNRKNE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|