C19H24ClFN2O — CID 174358715
2-amino-N-(3-ethylphenyl)-2-methylpropanamide;1-chloro-3-fluoro-5-methylbenzene (PubChem CID 174358715) has the molecular formula C19H24ClFN2O and a molecular weight of 350.87 g/mol. Its IUPAC name is 2-amino-N-(3-ethylphenyl)-2-methylpropanamide;1-chloro-3-fluoro-5-methylbenzene.
| Compound Name | 2-amino-N-(3-ethylphenyl)-2-methylpropanamide;1-chloro-3-fluoro-5-methylbenzene |
|---|---|
| PubChem CID | 174358715 |
| Molecular Formula | C19H24ClFN2O |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-amino-N-(3-ethylphenyl)-2-methylpropanamide;1-chloro-3-fluoro-5-methylbenzene |
| SMILES | CCc1cccc(NC(=O)C(C)(C)N)c1.Cc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C12H18N2O.C7H6ClF/c1-4-9-6-5-7-10(8-9)14-11(15)12(2,3)13;1-5-2-6(8)4-7(9)3-5/h5-8H,4,13H2,1-3H3,(H,14,15);2-4H,1H3 |
| InChIKey | NJYWCNMQPBTKFF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |