C19H23N3 — CID 174358789
2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine (PubChem CID 174358789) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine.
| Compound Name | 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine |
|---|---|
| PubChem CID | 174358789 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine |
| SMILES | C=C/C=C(\C=C/C)N/C(N=C(C=C)/C(C=C)=C/C=C)=N\C=C |
| InChI | InChI=1S/C19H23N3/c1-7-13-16(10-4)18(11-5)22-19(20-12-6)21-17(14-8-2)15-9-3/h7-15H,1-2,4-6H2,3H3,(H,20,21)/b15-9-,16-13+,17-14+,22-18? |
| InChIKey | QOGJFTPKLHQIMO-TYVBFAKYSA-N |
| XLogP | 4.65 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|