C20H23N3 — CID 174358814
2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine (PubChem CID 174358814) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine.
| Compound Name | 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine |
|---|---|
| PubChem CID | 174358814 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-ethenyl-1-[(4E)-4-ethenylhepta-1,4,6-trien-3-ylidene]-3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C=C)N/C(N=C(C=C)/C(C=C)=C/C=C)=N\C=C |
| InChI | InChI=1S/C20H23N3/c1-7-13-16-18(15-9-3)22-20(21-12-6)23-19(11-5)17(10-4)14-8-2/h7-16H,1-6H2,(H,21,22)/b16-13-,17-14+,18-15+,23-19? |
| InChIKey | DMBNRXKMHIPDFV-CMGJEXFQSA-N |
| XLogP | 4.81 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|