C24H42O5 — CID 174359349
(4-tert-butylcyclohexyl) 1-[4-(2-methylbutan-2-yl)cyclohexyl]oxyethenoxy carbonate (PubChem CID 174359349) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 1-[4-(2-methylbutan-2-yl)cyclohexyl]oxyethenoxy carbonate.
| Compound Name | (4-tert-butylcyclohexyl) 1-[4-(2-methylbutan-2-yl)cyclohexyl]oxyethenoxy carbonate |
|---|---|
| PubChem CID | 174359349 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | (4-tert-butylcyclohexyl) 1-[4-(2-methylbutan-2-yl)cyclohexyl]oxyethenoxy carbonate |
| SMILES | C=C(OOC(=O)OC1CCC(C(C)(C)C)CC1)OC1CCC(C(C)(C)CC)CC1 |
| InChI | InChI=1S/C24H42O5/c1-8-24(6,7)19-11-15-20(16-12-19)26-17(2)28-29-22(25)27-21-13-9-18(10-14-21)23(3,4)5/h18-21H,2,8-16H2,1,3-7H3 |
| InChIKey | LWEAGESRRXEYHI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|