About prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate
prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate (PubChem CID 174359467) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate.
Molecular Properties
| Compound Name | prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate |
| PubChem CID | 174359467 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate |
| SMILES | C=C(C)S/C=N\NC |
| InChI | InChI=1S/C5H10N2S/c1-5(2)8-4-7-6-3/h4,6H,1H2,2-3H3/b7-4- |
| InChIKey | IDYCBJJOKXKKRI-DAXSKMNVSA-N |
| XLogP | 1.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate?
The IUPAC name of prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate (CID 174359467) is prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate.
What is the SMILES notation for prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate?
The canonical SMILES for prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate is C=C(C)S/C=N\NC.
What is the InChIKey of prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate?
The InChIKey is IDYCBJJOKXKKRI-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H10N2S/c1-5(2)8-4-7-6-3/h4,6H,1H2,2-3H3/b7-4-.
What are the key properties of prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate?
prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate has a molecular weight of 130.22 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl (1Z)-N-(methylamino)methanimidothioate is sourced from PubChem (CID 174359467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).