C23H18O5 — CID 174359651
3-(2,5-dihydroxy-3,4-dihydro-1H-chrysen-2-yl)furan-2-carboxylic acid (PubChem CID 174359651) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3,4-dihydro-1H-chrysen-2-yl)furan-2-carboxylic acid.
| Compound Name | 3-(2,5-dihydroxy-3,4-dihydro-1H-chrysen-2-yl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 174359651 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-(2,5-dihydroxy-3,4-dihydro-1H-chrysen-2-yl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1C1(O)CCc2c(ccc3c2c(O)cc2ccccc23)C1 |
| InChI | InChI=1S/C23H18O5/c24-19-11-13-3-1-2-4-15(13)17-6-5-14-12-23(27,9-7-16(14)20(17)19)18-8-10-28-21(18)22(25)26/h1-6,8,10-11,24,27H,7,9,12H2,(H,25,26) |
| InChIKey | GJGKVHWDVSWJQD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|