About methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane
methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane (PubChem CID 174359960) has the molecular formula C15H36O2
and a molecular weight of 248.45 g/mol. Its IUPAC name is methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane.
Molecular Properties
| Compound Name | methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane |
| PubChem CID | 174359960 |
| Molecular Formula | C15H36O2 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.27 |
| IUPAC Name | methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane |
| SMILES | C.CC(C)(C)OC(C)(C)C.CC(C)OC(C)C |
| InChI | InChI=1S/C8H18O.C6H14O.CH4/c1-7(2,3)9-8(4,5)6;1-5(2)7-6(3)4;/h1-6H3;5-6H,1-4H3;1H4 |
| InChIKey | BETBESWJBLYMRG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane?
The IUPAC name of methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane (CID 174359960) is methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane.
What is the SMILES notation for methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane?
The canonical SMILES for methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane is C.CC(C)(C)OC(C)(C)C.CC(C)OC(C)C.
What is the InChIKey of methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane?
The InChIKey is BETBESWJBLYMRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C6H14O.CH4/c1-7(2,3)9-8(4,5)6;1-5(2)7-6(3)4;/h1-6H3;5-6H,1-4H3;1H4.
What are the key properties of methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane?
methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane has a molecular weight of 248.45 g/mol, XLogP of 5.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-propan-2-yloxypropane is sourced from PubChem (CID 174359960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).