C20H31ClFNO — CID 174360075
1-[4-[2-(4-fluorophenoxy)ethyl]cyclohexyl]-2-methylpiperidine;hydrochloride (PubChem CID 174360075) has the molecular formula C20H31ClFNO and a molecular weight of 355.93 g/mol. Its IUPAC name is 1-[4-[2-(4-fluorophenoxy)ethyl]cyclohexyl]-2-methylpiperidine;hydrochloride.
| Compound Name | 1-[4-[2-(4-fluorophenoxy)ethyl]cyclohexyl]-2-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 174360075 |
| Molecular Formula | C20H31ClFNO |
| Molecular Weight | 355.93 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-[4-[2-(4-fluorophenoxy)ethyl]cyclohexyl]-2-methylpiperidine;hydrochloride |
| SMILES | CC1CCCCN1C1CCC(CCOc2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C20H30FNO.ClH/c1-16-4-2-3-14-22(16)19-9-5-17(6-10-19)13-15-23-20-11-7-18(21)8-12-20;/h7-8,11-12,16-17,19H,2-6,9-10,13-15H2,1H3;1H |
| InChIKey | PFJFOGFFRAITMG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |