C19H25N3 — CID 174360217
2-ethenyl-1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine (PubChem CID 174360217) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-ethenyl-1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine.
| Compound Name | 2-ethenyl-1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine |
|---|---|
| PubChem CID | 174360217 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-ethenyl-1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-ylidene]-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C)C(C)=N/C(=N\C=C)NC(/C=C\C)=C/C=C |
| InChI | InChI=1S/C19H25N3/c1-7-12-15-17(10-4)16(6)21-19(20-11-5)22-18(13-8-2)14-9-3/h7-15H,1-2,5H2,3-4,6H3,(H,20,22)/b14-9-,15-12-,17-10+,18-13+,21-16? |
| InChIKey | XBGONPDURARSGS-ASXFDDDBSA-N |
| XLogP | 4.87 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|