C30H34N2O — CID 174360304
(4-aminophenyl)-[1-[1-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysen-5-yl]methanone (PubChem CID 174360304) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is (4-aminophenyl)-[1-[1-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysen-5-yl]methanone.
| Compound Name | (4-aminophenyl)-[1-[1-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysen-5-yl]methanone |
|---|---|
| PubChem CID | 174360304 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (4-aminophenyl)-[1-[1-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysen-5-yl]methanone |
| SMILES | CCC(C1CCCc2c1ccc1c2C(C(=O)c2ccc(N)cc2)Cc2ccccc2-1)N(C)C |
| InChI | InChI=1S/C30H34N2O/c1-4-28(32(2)3)24-10-7-11-25-23(24)16-17-26-22-9-6-5-8-20(22)18-27(29(25)26)30(33)19-12-14-21(31)15-13-19/h5-6,8-9,12-17,24,27-28H,4,7,10-11,18,31H2,1-3H3 |
| InChIKey | WPJWBYZRBNRFNE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|