C12H25N3O2S2 — CID 174360310
(2S)-2-(disulfanylamino)-3-methyl-N-[(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl]butanamide (PubChem CID 174360310) has the molecular formula C12H25N3O2S2 and a molecular weight of 307.49 g/mol. Its IUPAC name is (2S)-2-(disulfanylamino)-3-methyl-N-[(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl]butanamide.
| Compound Name | (2S)-2-(disulfanylamino)-3-methyl-N-[(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 174360310 |
| Molecular Formula | C12H25N3O2S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (2S)-2-(disulfanylamino)-3-methyl-N-[(2S)-1-(2-methylpropylamino)-1-oxopropan-2-yl]butanamide |
| SMILES | CC(C)CNC(=O)[C@H](C)NC(=O)[C@@H](NSS)C(C)C |
| InChI | InChI=1S/C12H25N3O2S2/c1-7(2)6-13-11(16)9(5)14-12(17)10(8(3)4)15-19-18/h7-10,15,18H,6H2,1-5H3,(H,13,16)(H,14,17)/t9-,10-/m0/s1 |
| InChIKey | LEBMZYUAYXUBMW-UWVGGRQHSA-N |
| XLogP | 1.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|