C20H19F2N7O — CID 174360457
2-[[[4-[2-[(1-cyclopropylpyrazol-4-yl)amino]-5-(difluoromethyl)pyrimidin-4-yl]phenyl]-hydroxymethyl]amino]acetonitrile (PubChem CID 174360457) has the molecular formula C20H19F2N7O and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-[[[4-[2-[(1-cyclopropylpyrazol-4-yl)amino]-5-(difluoromethyl)pyrimidin-4-yl]phenyl]-hydroxymethyl]amino]acetonitrile.
| Compound Name | 2-[[[4-[2-[(1-cyclopropylpyrazol-4-yl)amino]-5-(difluoromethyl)pyrimidin-4-yl]phenyl]-hydroxymethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 174360457 |
| Molecular Formula | C20H19F2N7O |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[[[4-[2-[(1-cyclopropylpyrazol-4-yl)amino]-5-(difluoromethyl)pyrimidin-4-yl]phenyl]-hydroxymethyl]amino]acetonitrile |
| SMILES | N#CCNC(O)c1ccc(-c2nc(Nc3cnn(C4CC4)c3)ncc2C(F)F)cc1 |
| InChI | InChI=1S/C20H19F2N7O/c21-18(22)16-10-25-20(27-14-9-26-29(11-14)15-5-6-15)28-17(16)12-1-3-13(4-2-12)19(30)24-8-7-23/h1-4,9-11,15,18-19,24,30H,5-6,8H2,(H,25,27,28) |
| InChIKey | ORNMCXXOJDTDIJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|