C14H2F8O — CID 174360692
1,2,3,4,5,6,7,8-octafluoro-9H-fluorene-9-carbaldehyde (PubChem CID 174360692) has the molecular formula C14H2F8O and a molecular weight of 338.15 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene-9-carbaldehyde.
| Compound Name | 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene-9-carbaldehyde |
|---|---|
| PubChem CID | 174360692 |
| Molecular Formula | C14H2F8O |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene-9-carbaldehyde |
| SMILES | O=CC1c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C14H2F8O/c15-7-3-2(1-23)4-6(5(3)9(17)13(21)11(7)19)10(18)14(22)12(20)8(4)16/h1-2H |
| InChIKey | WOYUQIGEGNOELX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|