About pentane;tetrachloromolybdenum
pentane;tetrachloromolybdenum (PubChem CID 174360833) has the molecular formula C5H11Cl4Mo-
and a molecular weight of 308.90 g/mol. Its IUPAC name is pentane;tetrachloromolybdenum.
Molecular Properties
| Compound Name | pentane;tetrachloromolybdenum |
| PubChem CID | 174360833 |
| Molecular Formula | C5H11Cl4Mo- |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.87 |
| IUPAC Name | pentane;tetrachloromolybdenum |
| SMILES | C[CH-]CCC.Cl[Mo](Cl)(Cl)Cl |
| InChI | InChI=1S/C5H11.4ClH.Mo/c1-3-5-4-2;;;;;/h3H,4-5H2,1-2H3;4*1H;/q-1;;;;;+4/p-4 |
| InChIKey | XQLBFSIRLFKXFF-UHFFFAOYSA-J |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentane;tetrachloromolybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane;tetrachloromolybdenum?
The IUPAC name of pentane;tetrachloromolybdenum (CID 174360833) is pentane;tetrachloromolybdenum.
What is the SMILES notation for pentane;tetrachloromolybdenum?
The canonical SMILES for pentane;tetrachloromolybdenum is C[CH-]CCC.Cl[Mo](Cl)(Cl)Cl.
What is the InChIKey of pentane;tetrachloromolybdenum?
The InChIKey is XQLBFSIRLFKXFF-UHFFFAOYSA-J. The full InChI is InChI=1S/C5H11.4ClH.Mo/c1-3-5-4-2;;;;;/h3H,4-5H2,1-2H3;4*1H;/q-1;;;;;+4/p-4.
What are the key properties of pentane;tetrachloromolybdenum?
pentane;tetrachloromolybdenum has a molecular weight of 308.90 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentane;tetrachloromolybdenum is sourced from PubChem (CID 174360833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).