About N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide
N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide (PubChem CID 174360841) has the molecular formula C23H45N3O
and a molecular weight of 379.63 g/mol. Its IUPAC name is N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide.
Molecular Properties
| Compound Name | N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide |
| PubChem CID | 174360841 |
| Molecular Formula | C23H45N3O |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.36 |
| IUPAC Name | N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide |
| SMILES | C=C(CCCCC(CCCCC(=C)NCCC)NC(=O)CCC)NCCC |
| InChI | InChI=1S/C23H45N3O/c1-6-13-23(27)26-22(16-11-9-14-20(4)24-18-7-2)17-12-10-15-21(5)25-19-8-3/h22,24-25H,4-19H2,1-3H3,(H,26,27) |
| InChIKey | JJOXRMJLUKURNM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide?
The IUPAC name of N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide (CID 174360841) is N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide.
What is the SMILES notation for N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide?
The canonical SMILES for N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide is C=C(CCCCC(CCCCC(=C)NCCC)NC(=O)CCC)NCCC.
What is the InChIKey of N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide?
The InChIKey is JJOXRMJLUKURNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H45N3O/c1-6-13-23(27)26-22(16-11-9-14-20(4)24-18-7-2)17-12-10-15-21(5)25-19-8-3/h22,24-25H,4-19H2,1-3H3,(H,26,27).
What are the key properties of N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide?
N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide has a molecular weight of 379.63 g/mol, XLogP of 5.42, 19 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,12-bis(propylamino)trideca-1,12-dien-7-yl]butanamide is sourced from PubChem (CID 174360841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).