About 1-phenylethyl N-(2-chlorophenyl)carbamate
1-phenylethyl N-(2-chlorophenyl)carbamate (PubChem CID 174361176) has the molecular formula C15H14ClNO2
and a molecular weight of 275.74 g/mol. Its IUPAC name is 1-phenylethyl N-(2-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | 1-phenylethyl N-(2-chlorophenyl)carbamate |
| PubChem CID | 174361176 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-phenylethyl N-(2-chlorophenyl)carbamate |
| SMILES | CC(OC(=O)Nc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H14ClNO2/c1-11(12-7-3-2-4-8-12)19-15(18)17-14-10-6-5-9-13(14)16/h2-11H,1H3,(H,17,18) |
| InChIKey | KUKVQIKKPYRIBX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylethyl N-(2-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl N-(2-chlorophenyl)carbamate?
The IUPAC name of 1-phenylethyl N-(2-chlorophenyl)carbamate (CID 174361176) is 1-phenylethyl N-(2-chlorophenyl)carbamate.
What is the SMILES notation for 1-phenylethyl N-(2-chlorophenyl)carbamate?
The canonical SMILES for 1-phenylethyl N-(2-chlorophenyl)carbamate is CC(OC(=O)Nc1ccccc1Cl)c1ccccc1.
What is the InChIKey of 1-phenylethyl N-(2-chlorophenyl)carbamate?
The InChIKey is KUKVQIKKPYRIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO2/c1-11(12-7-3-2-4-8-12)19-15(18)17-14-10-6-5-9-13(14)16/h2-11H,1H3,(H,17,18).
What are the key properties of 1-phenylethyl N-(2-chlorophenyl)carbamate?
1-phenylethyl N-(2-chlorophenyl)carbamate has a molecular weight of 275.74 g/mol, XLogP of 4.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl N-(2-chlorophenyl)carbamate is sourced from PubChem (CID 174361176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).