C21H22Cl2N3O4S- — CID 174361471
1-[(2,4-dichlorophenyl)methyl]-6-[3-hydroxypentyl(sulfinato)carbamoyl]-2-methylbenzimidazole (PubChem CID 174361471) has the molecular formula C21H22Cl2N3O4S- and a molecular weight of 483.40 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-6-[3-hydroxypentyl(sulfinato)carbamoyl]-2-methylbenzimidazole.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-6-[3-hydroxypentyl(sulfinato)carbamoyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 174361471 |
| Molecular Formula | C21H22Cl2N3O4S- |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-6-[3-hydroxypentyl(sulfinato)carbamoyl]-2-methylbenzimidazole |
| SMILES | CCC(O)CCN(C(=O)c1ccc2nc(C)n(Cc3ccc(Cl)cc3Cl)c2c1)S(=O)[O-] |
| InChI | InChI=1S/C21H23Cl2N3O4S/c1-3-17(27)8-9-26(31(29)30)21(28)14-5-7-19-20(10-14)25(13(2)24-19)12-15-4-6-16(22)11-18(15)23/h4-7,10-11,17,27H,3,8-9,12H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | YRHHBGDAFLUGCM-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|