C66H41N3O — CID 174361847
2-phenyl-4-[7-(8-phenyldibenzofuran-1-yl)phenanthren-2-yl]-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine (PubChem CID 174361847) has the molecular formula C66H41N3O and a molecular weight of 892.07 g/mol. Its IUPAC name is 2-phenyl-4-[7-(8-phenyldibenzofuran-1-yl)phenanthren-2-yl]-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[7-(8-phenyldibenzofuran-1-yl)phenanthren-2-yl]-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174361847 |
| Molecular Formula | C66H41N3O |
| Molecular Weight | 892.07 g/mol |
| Exact Mass | 891.32 |
| IUPAC Name | 2-phenyl-4-[7-(8-phenyldibenzofuran-1-yl)phenanthren-2-yl]-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc3oc4cccc(-c5ccc6c(ccc7cc(-c8nc(-c9ccccc9)nc(-c9cccc(C%10(c%11ccccc%11)c%11ccccc%11-c%11ccccc%11%10)c9)n8)ccc76)c5)c4c3c2)cc1 |
| InChI | InChI=1S/C66H41N3O/c1-4-16-42(17-5-1)44-34-37-60-57(41-44)62-54(26-15-29-61(62)70-60)47-32-35-52-45(38-47)30-31-46-39-49(33-36-53(46)52)65-68-63(43-18-6-2-7-19-43)67-64(69-65)48-20-14-23-51(40-48)66(50-21-8-3-9-22-50)58-27-12-10-24-55(58)56-25-11-13-28-59(56)66/h1-41H |
| InChIKey | LBBBOIYZMOOIGK-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.07 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|