About 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene
2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene (PubChem CID 174362498) has the molecular formula C16H17ClO2S
and a molecular weight of 308.83 g/mol. Its IUPAC name is 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene.
Molecular Properties
| Compound Name | 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene |
| PubChem CID | 174362498 |
| Molecular Formula | C16H17ClO2S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene |
| SMILES | CCc1ccc(S(=O)(=O)CC)cc1.Clc1ccc2cc1-2 |
| InChI | InChI=1S/C10H14O2S.C6H3Cl/c1-3-9-5-7-10(8-6-9)13(11,12)4-2;7-6-2-1-4-3-5(4)6/h5-8H,3-4H2,1-2H3;1-3H |
| InChIKey | JTVCNGJLIDZZNF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene?
The IUPAC name of 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene (CID 174362498) is 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene.
What is the SMILES notation for 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene?
The canonical SMILES for 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene is CCc1ccc(S(=O)(=O)CC)cc1.Clc1ccc2cc1-2.
What is the InChIKey of 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene?
The InChIKey is JTVCNGJLIDZZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S.C6H3Cl/c1-3-9-5-7-10(8-6-9)13(11,12)4-2;7-6-2-1-4-3-5(4)6/h5-8H,3-4H2,1-2H3;1-3H.
What are the key properties of 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene?
2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene has a molecular weight of 308.83 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobicyclo[3.1.0]hexa-1,3,5-triene;1-ethyl-4-ethylsulfonylbenzene is sourced from PubChem (CID 174362498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).